C13H10Cl2OS — CID 81157333
(2,5-dichlorophenyl)-(3,5-dimethylthiophen-2-yl)methanone (PubChem CID 81157333) has the molecular formula C13H10Cl2OS and a molecular weight of 285.19 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-(3,5-dimethylthiophen-2-yl)methanone.
| Compound Name | (2,5-dichlorophenyl)-(3,5-dimethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 81157333 |
| Molecular Formula | C13H10Cl2OS |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | (2,5-dichlorophenyl)-(3,5-dimethylthiophen-2-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2cc(Cl)ccc2Cl)s1 |
| InChI | InChI=1S/C13H10Cl2OS/c1-7-5-8(2)17-13(7)12(16)10-6-9(14)3-4-11(10)15/h3-6H,1-2H3 |
| InChIKey | FUGKGHAQXKPGFO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |