C13H13NOS — CID 13113637
(2-aminophenyl)-(3,5-dimethylthiophen-2-yl)methanone (PubChem CID 13113637) has the molecular formula C13H13NOS and a molecular weight of 231.32 g/mol. Its IUPAC name is (2-aminophenyl)-(3,5-dimethylthiophen-2-yl)methanone.
| Compound Name | (2-aminophenyl)-(3,5-dimethylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 13113637 |
| Molecular Formula | C13H13NOS |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | (2-aminophenyl)-(3,5-dimethylthiophen-2-yl)methanone |
| SMILES | Cc1cc(C)c(C(=O)c2ccccc2N)s1 |
| InChI | InChI=1S/C13H13NOS/c1-8-7-9(2)16-13(8)12(15)10-5-3-4-6-11(10)14/h3-7H,14H2,1-2H3 |
| InChIKey | GYMDFCNFSPUNQD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|