C16H23NOS — CID 142861062
3,5-dimethylthiophene-2-carboxamide;ethane;toluene (PubChem CID 142861062) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is 3,5-dimethylthiophene-2-carboxamide;ethane;toluene.
| Compound Name | 3,5-dimethylthiophene-2-carboxamide;ethane;toluene |
|---|---|
| PubChem CID | 142861062 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 3,5-dimethylthiophene-2-carboxamide;ethane;toluene |
| SMILES | CC.Cc1cc(C)c(C(N)=O)s1.Cc1ccccc1 |
| InChI | InChI=1S/C7H9NOS.C7H8.C2H6/c1-4-3-5(2)10-6(4)7(8)9;1-7-5-3-2-4-6-7;1-2/h3H,1-2H3,(H2,8,9);2-6H,1H3;1-2H3 |
| InChIKey | JJLKDKRZVJMBFQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |