About 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid
4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 81157455) has the molecular formula C12H16O3S
and a molecular weight of 240.32 g/mol. Its IUPAC name is 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid.
Analyze 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid (CID 81157455) is 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid is Cc1cc(C)c(C(=O)CC(C)(C)C(=O)O)s1.
What is the InChIKey of 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is PHECTNMEOXYNQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-7-5-8(2)16-10(7)9(13)6-12(3,4)11(14)15/h5H,6H2,1-4H3,(H,14,15).
What are the key properties of 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid?
4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 240.32 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 81157455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).