C13H17NO4 — CID 107699577
4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 107699577) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 107699577 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | Cc1ccc(NC(=O)CC(C)(C)C(=O)O)cc1O |
| InChI | InChI=1S/C13H17NO4/c1-8-4-5-9(6-10(8)15)14-11(16)7-13(2,3)12(17)18/h4-6,15H,7H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | JMPZBIWVWZDIHP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |