4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid

C13H17NO4 — CID 107699577

IUPAC4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid
SMILESCc1ccc(NC(=O)CC(C)(C)C(=O)O)cc1O
InChIInChI=1S/C13H17NO4/c1-8-4-5-9(6-10(8)15)14-11(16)7-13(2,3)12(17)18/h4-6,15H,7H2,1-3H3,(H,14,16)(H,17,18)
InChIKeyJMPZBIWVWZDIHP-UHFFFAOYSA-N
MW251.28 g/mol
LogP2.14
Rot. Bonds4

About 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid

4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 107699577) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid.

Molecular Properties

Compound Name4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid
PubChem CID107699577
Molecular FormulaC13H17NO4
Molecular Weight251.28 g/mol
Exact Mass251.12
IUPAC Name4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid
SMILESCc1ccc(NC(=O)CC(C)(C)C(=O)O)cc1O
InChIInChI=1S/C13H17NO4/c1-8-4-5-9(6-10(8)15)14-11(16)7-13(2,3)12(17)18/h4-6,15H,7H2,1-3H3,(H,14,16)(H,17,18)
InChIKeyJMPZBIWVWZDIHP-UHFFFAOYSA-N
XLogP2.14
TPSA86.63 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500251.28
LogP ≤ 52.14
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid (CID 107699577) is 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid is Cc1ccc(NC(=O)CC(C)(C)C(=O)O)cc1O.
What is the InChIKey of 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is JMPZBIWVWZDIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-8-4-5-9(6-10(8)15)14-11(16)7-13(2,3)12(17)18/h4-6,15H,7H2,1-3H3,(H,14,16)(H,17,18).
What are the key properties of 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid?
4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 251.28 g/mol, XLogP of 2.14, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-hydroxy-4-methylanilino)-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 107699577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).