C15H20ClNO5 — CID 119133689
4-[3-chloro-4-(2-methoxyethoxy)anilino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 119133689) has the molecular formula C15H20ClNO5 and a molecular weight of 329.78 g/mol. Its IUPAC name is 4-[3-chloro-4-(2-methoxyethoxy)anilino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[3-chloro-4-(2-methoxyethoxy)anilino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 119133689 |
| Molecular Formula | C15H20ClNO5 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | 4-[3-chloro-4-(2-methoxyethoxy)anilino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | COCCOc1ccc(NC(=O)CC(C)(C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C15H20ClNO5/c1-15(2,14(19)20)9-13(18)17-10-4-5-12(11(16)8-10)22-7-6-21-3/h4-5,8H,6-7,9H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | SRRRLIYIRLXVLA-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|