C16H22ClNO4 — CID 100709951
(2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-cyclopropyl-2-methoxypropanamide (PubChem CID 100709951) has the molecular formula C16H22ClNO4 and a molecular weight of 327.81 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-cyclopropyl-2-methoxypropanamide.
| Compound Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-cyclopropyl-2-methoxypropanamide |
|---|---|
| PubChem CID | 100709951 |
| Molecular Formula | C16H22ClNO4 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-cyclopropyl-2-methoxypropanamide |
| SMILES | COCCOc1ccc(NC(=O)[C@](C)(OC)C2CC2)cc1Cl |
| InChI | InChI=1S/C16H22ClNO4/c1-16(21-3,11-4-5-11)15(19)18-12-6-7-14(13(17)10-12)22-9-8-20-2/h6-7,10-11H,4-5,8-9H2,1-3H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | PYMASCUBTTZIBE-MRXNPFEDSA-N |
| XLogP | 3.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|