C19H30ClNO4 — CID 100729354
(2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-ethoxy-2-methylheptanamide (PubChem CID 100729354) has the molecular formula C19H30ClNO4 and a molecular weight of 371.91 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-ethoxy-2-methylheptanamide.
| Compound Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-ethoxy-2-methylheptanamide |
|---|---|
| PubChem CID | 100729354 |
| Molecular Formula | C19H30ClNO4 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-ethoxy-2-methylheptanamide |
| SMILES | CCCCC[C@@](C)(OCC)C(=O)Nc1ccc(OCCOC)c(Cl)c1 |
| InChI | InChI=1S/C19H30ClNO4/c1-5-7-8-11-19(3,25-6-2)18(22)21-15-9-10-17(16(20)14-15)24-13-12-23-4/h9-10,14H,5-8,11-13H2,1-4H3,(H,21,22)/t19-/m1/s1 |
| InChIKey | FLLJGLLWHSXVAA-LJQANCHMSA-N |
| XLogP | 4.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|