C22H36ClNO4 — CID 100742589
(2R)-N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methyl-2-propoxyhexanamide (PubChem CID 100742589) has the molecular formula C22H36ClNO4 and a molecular weight of 413.99 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methyl-2-propoxyhexanamide.
| Compound Name | (2R)-N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methyl-2-propoxyhexanamide |
|---|---|
| PubChem CID | 100742589 |
| Molecular Formula | C22H36ClNO4 |
| Molecular Weight | 413.99 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (2R)-N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methyl-2-propoxyhexanamide |
| SMILES | CCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCCC(C)(C)OC)c(Cl)c1 |
| InChI | InChI=1S/C22H36ClNO4/c1-7-9-12-22(5,28-14-8-2)20(25)24-17-10-11-19(18(23)16-17)27-15-13-21(3,4)26-6/h10-11,16H,7-9,12-15H2,1-6H3,(H,24,25)/t22-/m1/s1 |
| InChIKey | QCJDZRSJAYHWLA-JOCHJYFZSA-N |
| XLogP | 5.85 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.99 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |