C21H34ClNO4 — CID 133246109
N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methoxy-2-methylheptanamide (PubChem CID 133246109) has the molecular formula C21H34ClNO4 and a molecular weight of 399.96 g/mol. Its IUPAC name is N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methoxy-2-methylheptanamide.
| Compound Name | N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methoxy-2-methylheptanamide |
|---|---|
| PubChem CID | 133246109 |
| Molecular Formula | C21H34ClNO4 |
| Molecular Weight | 399.96 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | N-[3-chloro-4-(3-methoxy-3-methylbutoxy)phenyl]-2-methoxy-2-methylheptanamide |
| SMILES | CCCCCC(C)(OC)C(=O)Nc1ccc(OCCC(C)(C)OC)c(Cl)c1 |
| InChI | InChI=1S/C21H34ClNO4/c1-7-8-9-12-21(4,26-6)19(24)23-16-10-11-18(17(22)15-16)27-14-13-20(2,3)25-5/h10-11,15H,7-9,12-14H2,1-6H3,(H,23,24) |
| InChIKey | XSDNTRSZJJXVNY-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.96 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|