C18H28ClNO4 — CID 100701068
(2S)-N-[3-chloro-4-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-2-methoxy-2-methylhexanamide (PubChem CID 100701068) has the molecular formula C18H28ClNO4 and a molecular weight of 357.88 g/mol. Its IUPAC name is (2S)-N-[3-chloro-4-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-2-methoxy-2-methylhexanamide.
| Compound Name | (2S)-N-[3-chloro-4-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-2-methoxy-2-methylhexanamide |
|---|---|
| PubChem CID | 100701068 |
| Molecular Formula | C18H28ClNO4 |
| Molecular Weight | 357.88 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S)-N-[3-chloro-4-[(2R)-1-methoxypropan-2-yl]oxyphenyl]-2-methoxy-2-methylhexanamide |
| SMILES | CCCC[C@](C)(OC)C(=O)Nc1ccc(O[C@H](C)COC)c(Cl)c1 |
| InChI | InChI=1S/C18H28ClNO4/c1-6-7-10-18(3,23-5)17(21)20-14-8-9-16(15(19)11-14)24-13(2)12-22-4/h8-9,11,13H,6-7,10,12H2,1-5H3,(H,20,21)/t13-,18+/m1/s1 |
| InChIKey | CTTYDRJLIALUND-ACJLOTCBSA-N |
| XLogP | 4.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |