C20H32ClNO4 — CID 100712148
(2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-methyl-2-propoxyheptanamide (PubChem CID 100712148) has the molecular formula C20H32ClNO4 and a molecular weight of 385.93 g/mol. Its IUPAC name is (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-methyl-2-propoxyheptanamide.
| Compound Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-methyl-2-propoxyheptanamide |
|---|---|
| PubChem CID | 100712148 |
| Molecular Formula | C20H32ClNO4 |
| Molecular Weight | 385.93 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | (2R)-N-[3-chloro-4-(2-methoxyethoxy)phenyl]-2-methyl-2-propoxyheptanamide |
| SMILES | CCCCC[C@@](C)(OCCC)C(=O)Nc1ccc(OCCOC)c(Cl)c1 |
| InChI | InChI=1S/C20H32ClNO4/c1-5-7-8-11-20(3,26-12-6-2)19(23)22-16-9-10-18(17(21)15-16)25-14-13-24-4/h9-10,15H,5-8,11-14H2,1-4H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | WKGNEBRPHMSECK-HXUWFJFHSA-N |
| XLogP | 5.07 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.93 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|