C19H27NO5 — CID 133229936
methyl 2-butoxy-5-[(2-cyclopropyl-2-methoxypropanoyl)amino]benzoate (PubChem CID 133229936) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 2-butoxy-5-[(2-cyclopropyl-2-methoxypropanoyl)amino]benzoate.
| Compound Name | methyl 2-butoxy-5-[(2-cyclopropyl-2-methoxypropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 133229936 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | methyl 2-butoxy-5-[(2-cyclopropyl-2-methoxypropanoyl)amino]benzoate |
| SMILES | CCCCOc1ccc(NC(=O)C(C)(OC)C2CC2)cc1C(=O)OC |
| InChI | InChI=1S/C19H27NO5/c1-5-6-11-25-16-10-9-14(12-15(16)17(21)23-3)20-18(22)19(2,24-4)13-7-8-13/h9-10,12-13H,5-8,11H2,1-4H3,(H,20,22) |
| InChIKey | QGYRKMSTTXGYKV-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|