C17H23NO5 — CID 100763279
methyl 5-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]-2-methoxybenzoate (PubChem CID 100763279) has the molecular formula C17H23NO5 and a molecular weight of 321.37 g/mol. Its IUPAC name is methyl 5-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]-2-methoxybenzoate.
| Compound Name | methyl 5-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 100763279 |
| Molecular Formula | C17H23NO5 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | methyl 5-[[(2R)-2-cyclopropyl-2-ethoxypropanoyl]amino]-2-methoxybenzoate |
| SMILES | CCO[C@@](C)(C(=O)Nc1ccc(OC)c(C(=O)OC)c1)C1CC1 |
| InChI | InChI=1S/C17H23NO5/c1-5-23-17(2,11-6-7-11)16(20)18-12-8-9-14(21-3)13(10-12)15(19)22-4/h8-11H,5-7H2,1-4H3,(H,18,20)/t17-/m1/s1 |
| InChIKey | FYSGWCIWDYPCLU-QGZVFWFLSA-N |
| XLogP | 2.63 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |