3,5-dimethylthiophene-2-carboxylic acid

C7H8O2S — CID 819558

IUPAC3,5-dimethylthiophene-2-carboxylic acid
SMILESCc1cc(C)c(C(=O)O)s1
InChIInChI=1S/C7H8O2S/c1-4-3-5(2)10-6(4)7(8)9/h3H,1-2H3,(H,8,9)
InChIKeyQGQBKGYXFUDGDQ-UHFFFAOYSA-N
MW156.21 g/mol
LogP2.06
Rot. Bonds1

About 3,5-dimethylthiophene-2-carboxylic acid

3,5-dimethylthiophene-2-carboxylic acid (PubChem CID 819558) has the molecular formula C7H8O2S and a molecular weight of 156.21 g/mol. Its IUPAC name is 3,5-dimethylthiophene-2-carboxylic acid.

Molecular Properties

Compound Name3,5-dimethylthiophene-2-carboxylic acid
PubChem CID819558
Molecular FormulaC7H8O2S
Molecular Weight156.21 g/mol
Exact Mass156.02
IUPAC Name3,5-dimethylthiophene-2-carboxylic acid
SMILESCc1cc(C)c(C(=O)O)s1
InChIInChI=1S/C7H8O2S/c1-4-3-5(2)10-6(4)7(8)9/h3H,1-2H3,(H,8,9)
InChIKeyQGQBKGYXFUDGDQ-UHFFFAOYSA-N
XLogP2.06
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.21
LogP ≤ 52.06
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,5-dimethylthiophene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-methyl-5-phosphanylthiophene-2-carboxylic acid
CID 58094814
ethane;3-fluoro-5-methylthiophene-2-carboxylic acid
CID 166145791
4-(3,5-dimethylthiophen-2-yl)-2,2-dimethyl-4-oxobutanoic acid
CID 81157455
5-formyl-3-methylthiophene-2-carboxylic acid
CID 82412510
3,5-dimethylthiophene-2-carboxamide;ethane;toluene
CID 142861062
3-methyl-5-sulfamoylthiophene-2-carboxylic acid
CID 43314426
1-(3,5-dimethylthiophen-2-yl)-4-methylpentan-1-one
CID 81156374
3-methyl-5-[(2-methylpropan-2-yl)oxycarbonyl]thiophene-2-carboxylic acid
CID 150499338
5-[hydroxy(methyl)sulfamoyl]-3-methylthiophene-2-carboxylic acid
CID 127020813
5-(1,3-dioxol-2-yl)-3-methylthiophene-2-carboxylic acid
CID 141266786
(3,5-dimethylthiophen-2-yl)-(5-methylfuran-2-yl)methanone
CID 81155979
1-(3,5-dimethylthiophen-2-yl)nonan-1-one
CID 81157451

Frequently Asked Questions

What is the IUPAC name of 3,5-dimethylthiophene-2-carboxylic acid?
The IUPAC name of 3,5-dimethylthiophene-2-carboxylic acid (CID 819558) is 3,5-dimethylthiophene-2-carboxylic acid.
What is the SMILES notation for 3,5-dimethylthiophene-2-carboxylic acid?
The canonical SMILES for 3,5-dimethylthiophene-2-carboxylic acid is Cc1cc(C)c(C(=O)O)s1.
What is the InChIKey of 3,5-dimethylthiophene-2-carboxylic acid?
The InChIKey is QGQBKGYXFUDGDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S/c1-4-3-5(2)10-6(4)7(8)9/h3H,1-2H3,(H,8,9).
What are the key properties of 3,5-dimethylthiophene-2-carboxylic acid?
3,5-dimethylthiophene-2-carboxylic acid has a molecular weight of 156.21 g/mol, XLogP of 2.06, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethylthiophene-2-carboxylic acid is sourced from PubChem (CID 819558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).