C15H24OS — CID 81157451
1-(3,5-dimethylthiophen-2-yl)nonan-1-one (PubChem CID 81157451) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is 1-(3,5-dimethylthiophen-2-yl)nonan-1-one.
| Compound Name | 1-(3,5-dimethylthiophen-2-yl)nonan-1-one |
|---|---|
| PubChem CID | 81157451 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 1-(3,5-dimethylthiophen-2-yl)nonan-1-one |
| SMILES | CCCCCCCCC(=O)c1sc(C)cc1C |
| InChI | InChI=1S/C15H24OS/c1-4-5-6-7-8-9-10-14(16)15-12(2)11-13(3)17-15/h11H,4-10H2,1-3H3 |
| InChIKey | JAVOBEKNJOZBJN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|