C13H13Cl2FO — CID 146009541
cyclohexyl-(2,5-dichloro-3-fluorophenyl)methanone (PubChem CID 146009541) has the molecular formula C13H13Cl2FO and a molecular weight of 275.15 g/mol. Its IUPAC name is cyclohexyl-(2,5-dichloro-3-fluorophenyl)methanone.
| Compound Name | cyclohexyl-(2,5-dichloro-3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 146009541 |
| Molecular Formula | C13H13Cl2FO |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | cyclohexyl-(2,5-dichloro-3-fluorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(F)c1Cl)C1CCCCC1 |
| InChI | InChI=1S/C13H13Cl2FO/c14-9-6-10(12(15)11(16)7-9)13(17)8-4-2-1-3-5-8/h6-8H,1-5H2 |
| InChIKey | JZTPPORPUSUETB-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|