C11H3Cl2F9O — CID 146009488
1-(2,3-dichlorophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one (PubChem CID 146009488) has the molecular formula C11H3Cl2F9O and a molecular weight of 393.03 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one.
| Compound Name | 1-(2,3-dichlorophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
|---|---|
| PubChem CID | 146009488 |
| Molecular Formula | C11H3Cl2F9O |
| Molecular Weight | 393.03 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
| SMILES | O=C(c1cccc(Cl)c1Cl)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H3Cl2F9O/c12-5-3-1-2-4(6(5)13)7(23)8(14,15)9(16,17)10(18,19)11(20,21)22/h1-3H |
| InChIKey | FJDRLWVAYVUABP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.03 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|