C13H9F9O — CID 146006566
1-(2-ethylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one (PubChem CID 146006566) has the molecular formula C13H9F9O and a molecular weight of 352.20 g/mol. Its IUPAC name is 1-(2-ethylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one.
| Compound Name | 1-(2-ethylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
|---|---|
| PubChem CID | 146006566 |
| Molecular Formula | C13H9F9O |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | 1-(2-ethylphenyl)-2,2,3,3,4,4,5,5,5-nonafluoropentan-1-one |
| SMILES | CCc1ccccc1C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H9F9O/c1-2-7-5-3-4-6-8(7)9(23)10(14,15)11(16,17)12(18,19)13(20,21)22/h3-6H,2H2,1H3 |
| InChIKey | GTXQPUMROYUNFD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|