About barium(2+);bis(2-ethylbenzoate)
barium(2+);bis(2-ethylbenzoate) (PubChem CID 101299927) has the molecular formula C18H18BaO4
and a molecular weight of 435.67 g/mol. Its IUPAC name is barium(2+);bis(2-ethylbenzoate).
Molecular Properties
| Compound Name | barium(2+);bis(2-ethylbenzoate) |
| PubChem CID | 101299927 |
| Molecular Formula | C18H18BaO4 |
| Molecular Weight | 435.67 g/mol |
| Exact Mass | 436.03 |
| IUPAC Name | barium(2+);bis(2-ethylbenzoate) |
| SMILES | CCc1ccccc1C(=O)[O-].CCc1ccccc1C(=O)[O-].[Ba+2] |
| InChI | InChI=1S/2C9H10O2.Ba/c2*1-2-7-5-3-4-6-8(7)9(10)11;/h2*3-6H,2H2,1H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | BNBLHUVMZFWOBS-UHFFFAOYSA-L |
| XLogP | 0.84 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.67 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze barium(2+);bis(2-ethylbenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(2-ethylbenzoate)?
The IUPAC name of barium(2+);bis(2-ethylbenzoate) (CID 101299927) is barium(2+);bis(2-ethylbenzoate).
What is the SMILES notation for barium(2+);bis(2-ethylbenzoate)?
The canonical SMILES for barium(2+);bis(2-ethylbenzoate) is CCc1ccccc1C(=O)[O-].CCc1ccccc1C(=O)[O-].[Ba+2].
What is the InChIKey of barium(2+);bis(2-ethylbenzoate)?
The InChIKey is BNBLHUVMZFWOBS-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H10O2.Ba/c2*1-2-7-5-3-4-6-8(7)9(10)11;/h2*3-6H,2H2,1H3,(H,10,11);/q;;+2/p-2.
What are the key properties of barium(2+);bis(2-ethylbenzoate)?
barium(2+);bis(2-ethylbenzoate) has a molecular weight of 435.67 g/mol, XLogP of 0.84, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(2-ethylbenzoate) is sourced from PubChem (CID 101299927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).