C16H19O7-3 — CID 54474002
2-ethylbenzoate;3-methoxy-3-methylpentanedioate (PubChem CID 54474002) has the molecular formula C16H19O7-3 and a molecular weight of 323.32 g/mol. Its IUPAC name is 2-ethylbenzoate;3-methoxy-3-methylpentanedioate.
| Compound Name | 2-ethylbenzoate;3-methoxy-3-methylpentanedioate |
|---|---|
| PubChem CID | 54474002 |
| Molecular Formula | C16H19O7-3 |
| Molecular Weight | 323.32 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 2-ethylbenzoate;3-methoxy-3-methylpentanedioate |
| SMILES | CCc1ccccc1C(=O)[O-].COC(C)(CC(=O)[O-])CC(=O)[O-] |
| InChI | InChI=1S/C9H10O2.C7H12O5/c1-2-7-5-3-4-6-8(7)9(10)11;1-7(12-2,3-5(8)9)4-6(10)11/h3-6H,2H2,1H3,(H,10,11);3-4H2,1-2H3,(H,8,9)(H,10,11)/p-3 |
| InChIKey | XKGZPDNGIMWXRV-UHFFFAOYSA-K |
| XLogP | -1.72 |
| TPSA | 129.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.32 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |