C12H3F13O — CID 146009000
2,2,3,3,4,4,5,5,5-nonafluoro-1-[3-fluoro-2-(trifluoromethyl)phenyl]pentan-1-one (PubChem CID 146009000) has the molecular formula C12H3F13O and a molecular weight of 410.13 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoro-1-[3-fluoro-2-(trifluoromethyl)phenyl]pentan-1-one.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-[3-fluoro-2-(trifluoromethyl)phenyl]pentan-1-one |
|---|---|
| PubChem CID | 146009000 |
| Molecular Formula | C12H3F13O |
| Molecular Weight | 410.13 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoro-1-[3-fluoro-2-(trifluoromethyl)phenyl]pentan-1-one |
| SMILES | O=C(c1cccc(F)c1C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H3F13O/c13-5-3-1-2-4(6(5)9(16,17)18)7(26)8(14,15)10(19,20)11(21,22)12(23,24)25/h1-3H |
| InChIKey | FOLSWCTUFAYOOZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.13 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|