C9H3Cl3F4O — CID 146009003
2,2,2-trichloro-1-[3-fluoro-2-(trifluoromethyl)phenyl]ethanone (PubChem CID 146009003) has the molecular formula C9H3Cl3F4O and a molecular weight of 309.47 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[3-fluoro-2-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[3-fluoro-2-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 146009003 |
| Molecular Formula | C9H3Cl3F4O |
| Molecular Weight | 309.47 g/mol |
| Exact Mass | 307.92 |
| IUPAC Name | 2,2,2-trichloro-1-[3-fluoro-2-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(c1cccc(F)c1C(F)(F)F)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H3Cl3F4O/c10-8(11,12)7(17)4-2-1-3-5(13)6(4)9(14,15)16/h1-3H |
| InChIKey | IQMYZHSNUWEPQB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|