C12H6Cl3FO — CID 146006982
2,2,2-trichloro-1-(4-fluoronaphthalen-1-yl)ethanone (PubChem CID 146006982) has the molecular formula C12H6Cl3FO and a molecular weight of 291.54 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(4-fluoronaphthalen-1-yl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(4-fluoronaphthalen-1-yl)ethanone |
|---|---|
| PubChem CID | 146006982 |
| Molecular Formula | C12H6Cl3FO |
| Molecular Weight | 291.54 g/mol |
| Exact Mass | 289.95 |
| IUPAC Name | 2,2,2-trichloro-1-(4-fluoronaphthalen-1-yl)ethanone |
| SMILES | O=C(c1ccc(F)c2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H6Cl3FO/c13-12(14,15)11(17)9-5-6-10(16)8-4-2-1-3-7(8)9/h1-6H |
| InChIKey | JNBMUZKBNIDLQO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.54 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|