About 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate
3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate (PubChem CID 114088303) has the molecular formula C16H17FO2
and a molecular weight of 260.31 g/mol. Its IUPAC name is 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate.
Molecular Properties
| Compound Name | 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate |
| PubChem CID | 114088303 |
| Molecular Formula | C16H17FO2 |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate |
| SMILES | CC(C)C(C)OC(=O)c1ccc(F)c2ccccc12 |
| InChI | InChI=1S/C16H17FO2/c1-10(2)11(3)19-16(18)14-8-9-15(17)13-7-5-4-6-12(13)14/h4-11H,1-3H3 |
| InChIKey | FVSUGIHUBGHARO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate?
The IUPAC name of 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate (CID 114088303) is 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate.
What is the SMILES notation for 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate?
The canonical SMILES for 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate is CC(C)C(C)OC(=O)c1ccc(F)c2ccccc12.
What is the InChIKey of 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate?
The InChIKey is FVSUGIHUBGHARO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17FO2/c1-10(2)11(3)19-16(18)14-8-9-15(17)13-7-5-4-6-12(13)14/h4-11H,1-3H3.
What are the key properties of 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate?
3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate has a molecular weight of 260.31 g/mol, XLogP of 4.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-2-yl 4-fluoronaphthalene-1-carboxylate is sourced from PubChem (CID 114088303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).