C16H14FNO4 — CID 122191729
[(1S)-2-amino-1-(2-methyloxiran-2-yl)-2-oxoethyl] 4-fluoronaphthalene-1-carboxylate (PubChem CID 122191729) has the molecular formula C16H14FNO4 and a molecular weight of 303.29 g/mol. Its IUPAC name is [(1S)-2-amino-1-(2-methyloxiran-2-yl)-2-oxoethyl] 4-fluoronaphthalene-1-carboxylate.
| Compound Name | [(1S)-2-amino-1-(2-methyloxiran-2-yl)-2-oxoethyl] 4-fluoronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 122191729 |
| Molecular Formula | C16H14FNO4 |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | [(1S)-2-amino-1-(2-methyloxiran-2-yl)-2-oxoethyl] 4-fluoronaphthalene-1-carboxylate |
| SMILES | CC1([C@H](OC(=O)c2ccc(F)c3ccccc23)C(N)=O)CO1 |
| InChI | InChI=1S/C16H14FNO4/c1-16(8-21-16)13(14(18)19)22-15(20)11-6-7-12(17)10-5-3-2-4-9(10)11/h2-7,13H,8H2,1H3,(H2,18,19)/t13-,16?/m1/s1 |
| InChIKey | LYVDVAYYWVHEKM-JBZHPUCOSA-N |
| XLogP | 1.78 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|