C24H26N2O8 — CID 101441701
[(1S)-2-[[2-[[(E)-1-hydroxy-3-oxobut-1-en-2-yl]amino]-2-oxoethyl]amino]-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate (PubChem CID 101441701) has the molecular formula C24H26N2O8 and a molecular weight of 470.48 g/mol. Its IUPAC name is [(1S)-2-[[2-[[(E)-1-hydroxy-3-oxobut-1-en-2-yl]amino]-2-oxoethyl]amino]-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate.
| Compound Name | [(1S)-2-[[2-[[(E)-1-hydroxy-3-oxobut-1-en-2-yl]amino]-2-oxoethyl]amino]-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 101441701 |
| Molecular Formula | C24H26N2O8 |
| Molecular Weight | 470.48 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | [(1S)-2-[[2-[[(E)-1-hydroxy-3-oxobut-1-en-2-yl]amino]-2-oxoethyl]amino]-1-[(2S)-2-methyloxiran-2-yl]-2-oxoethyl] 3-methoxy-5-methylnaphthalene-1-carboxylate |
| SMILES | COc1cc(C(=O)O[C@H](C(=O)NCC(=O)N/C(=C/O)C(C)=O)[C@]2(C)CO2)c2cccc(C)c2c1 |
| InChI | InChI=1S/C24H26N2O8/c1-13-6-5-7-16-17(13)8-15(32-4)9-18(16)23(31)34-21(24(3)12-33-24)22(30)25-10-20(29)26-19(11-27)14(2)28/h5-9,11,21,27H,10,12H2,1-4H3,(H,25,30)(H,26,29)/b19-11+/t21-,24+/m1/s1 |
| InChIKey | DMOPJIFCMMQZAA-QRWLZIASSA-N |
| XLogP | 1.69 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.48 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|