C30H26O5 — CID 142000328
methyl 2,2-bis(4-methoxyphenyl)-7-methylbenzo[h]chromene-5-carboxylate (PubChem CID 142000328) has the molecular formula C30H26O5 and a molecular weight of 466.53 g/mol. Its IUPAC name is methyl 2,2-bis(4-methoxyphenyl)-7-methylbenzo[h]chromene-5-carboxylate.
| Compound Name | methyl 2,2-bis(4-methoxyphenyl)-7-methylbenzo[h]chromene-5-carboxylate |
|---|---|
| PubChem CID | 142000328 |
| Molecular Formula | C30H26O5 |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | methyl 2,2-bis(4-methoxyphenyl)-7-methylbenzo[h]chromene-5-carboxylate |
| SMILES | COC(=O)c1cc2c(C)cccc2c2c1C=CC(c1ccc(OC)cc1)(c1ccc(OC)cc1)O2 |
| InChI | InChI=1S/C30H26O5/c1-19-6-5-7-24-26(19)18-27(29(31)34-4)25-16-17-30(35-28(24)25,20-8-12-22(32-2)13-9-20)21-10-14-23(33-3)15-11-21/h5-18H,1-4H3 |
| InChIKey | IEPNZEZWPYLREF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |