C35H29NO4 — CID 3124843
3,3-bis(4-methoxyphenyl)-N-(4-methylphenyl)benzo[f]chromene-5-carboxamide (PubChem CID 3124843) has the molecular formula C35H29NO4 and a molecular weight of 527.62 g/mol. Its IUPAC name is 3,3-bis(4-methoxyphenyl)-N-(4-methylphenyl)benzo[f]chromene-5-carboxamide.
| Compound Name | 3,3-bis(4-methoxyphenyl)-N-(4-methylphenyl)benzo[f]chromene-5-carboxamide |
|---|---|
| PubChem CID | 3124843 |
| Molecular Formula | C35H29NO4 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | 3,3-bis(4-methoxyphenyl)-N-(4-methylphenyl)benzo[f]chromene-5-carboxamide |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)C=Cc3c(c(C(=O)Nc4ccc(C)cc4)cc4ccccc34)O2)cc1 |
| InChI | InChI=1S/C35H29NO4/c1-23-8-14-27(15-9-23)36-34(37)32-22-24-6-4-5-7-30(24)31-20-21-35(40-33(31)32,25-10-16-28(38-2)17-11-25)26-12-18-29(39-3)19-13-26/h4-22H,1-3H3,(H,36,37) |
| InChIKey | YXTDBXDTYKIZIA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |