C30H27NO3 — CID 132609095
tert-butyl N-(3,3-diphenylbenzo[f]chromen-5-yl)carbamate (PubChem CID 132609095) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is tert-butyl N-(3,3-diphenylbenzo[f]chromen-5-yl)carbamate.
| Compound Name | tert-butyl N-(3,3-diphenylbenzo[f]chromen-5-yl)carbamate |
|---|---|
| PubChem CID | 132609095 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | tert-butyl N-(3,3-diphenylbenzo[f]chromen-5-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc2ccccc2c2c1OC(c1ccccc1)(c1ccccc1)C=C2 |
| InChI | InChI=1S/C30H27NO3/c1-29(2,3)34-28(32)31-26-20-21-12-10-11-17-24(21)25-18-19-30(33-27(25)26,22-13-6-4-7-14-22)23-15-8-5-9-16-23/h4-20H,1-3H3,(H,31,32) |
| InChIKey | QWMLZZFTGLIBBV-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |