C27H35N3O2 — CID 174633482
tert-butyl N-(1,2,3,4-tetrahydrochrysen-5-yl)carbamate;piperazine (PubChem CID 174633482) has the molecular formula C27H35N3O2 and a molecular weight of 433.60 g/mol. Its IUPAC name is tert-butyl N-(1,2,3,4-tetrahydrochrysen-5-yl)carbamate;piperazine.
| Compound Name | tert-butyl N-(1,2,3,4-tetrahydrochrysen-5-yl)carbamate;piperazine |
|---|---|
| PubChem CID | 174633482 |
| Molecular Formula | C27H35N3O2 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.27 |
| IUPAC Name | tert-butyl N-(1,2,3,4-tetrahydrochrysen-5-yl)carbamate;piperazine |
| SMILES | C1CNCCN1.CC(C)(C)OC(=O)Nc1cc2ccccc2c2ccc3c(c12)CCCC3 |
| InChI | InChI=1S/C23H25NO2.C4H10N2/c1-23(2,3)26-22(25)24-20-14-16-9-5-6-10-17(16)19-13-12-15-8-4-7-11-18(15)21(19)20;1-2-6-4-3-5-1/h5-6,9-10,12-14H,4,7-8,11H2,1-3H3,(H,24,25);5-6H,1-4H2 |
| InChIKey | XAOWYIAVTDMXHA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|