C21H31N3O4 — CID 137072408
tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)carbamimidoyl]carbamate (PubChem CID 137072408) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 137072408 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-(5,6,7,8-tetrahydronaphthalen-1-yl)carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1cccc2c1CCCC2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H31N3O4/c1-20(2,3)27-18(25)23-17(24-19(26)28-21(4,5)6)22-16-13-9-11-14-10-7-8-12-15(14)16/h9,11,13H,7-8,10,12H2,1-6H3,(H2,22,23,24,25,26) |
| InChIKey | VPGMBGURWDAKKK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|