C35H48N6O8 — CID 135499706
tert-butyl N-[N'-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-9H-fluoren-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 135499706) has the molecular formula C35H48N6O8 and a molecular weight of 680.80 g/mol. Its IUPAC name is tert-butyl N-[N'-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-9H-fluoren-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-9H-fluoren-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135499706 |
| Molecular Formula | C35H48N6O8 |
| Molecular Weight | 680.80 g/mol |
| Exact Mass | 680.35 |
| IUPAC Name | tert-butyl N-[N'-[7-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-9H-fluoren-2-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc2c(c1)Cc1cc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)ccc1-2)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H48N6O8/c1-32(2,3)46-28(42)38-26(39-29(43)47-33(4,5)6)36-22-13-15-24-20(18-22)17-21-19-23(14-16-25(21)24)37-27(40-30(44)48-34(7,8)9)41-31(45)49-35(10,11)12/h13-16,18-19H,17H2,1-12H3,(H2,36,38,39,42,43)(H2,37,40,41,44,45) |
| InChIKey | SUQARWSXULIXMI-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 178.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.80 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|