C22H25NO2 — CID 170491424
tert-butyl N-[4-(9H-fluoren-2-yl)but-3-enyl]carbamate (PubChem CID 170491424) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is tert-butyl N-[4-(9H-fluoren-2-yl)but-3-enyl]carbamate.
| Compound Name | tert-butyl N-[4-(9H-fluoren-2-yl)but-3-enyl]carbamate |
|---|---|
| PubChem CID | 170491424 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl N-[4-(9H-fluoren-2-yl)but-3-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC=Cc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C22H25NO2/c1-22(2,3)25-21(24)23-13-7-6-8-16-11-12-20-18(14-16)15-17-9-4-5-10-19(17)20/h4-6,8-12,14H,7,13,15H2,1-3H3,(H,23,24) |
| InChIKey | QXNCZVIUCDINII-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|