C24H32N6O5 — CID 135926359
tert-butyl N-[N'-[4-[(4-aminophenyl)carbamoylamino]phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 135926359) has the molecular formula C24H32N6O5 and a molecular weight of 484.56 g/mol. Its IUPAC name is tert-butyl N-[N'-[4-[(4-aminophenyl)carbamoylamino]phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[4-[(4-aminophenyl)carbamoylamino]phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135926359 |
| Molecular Formula | C24H32N6O5 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | tert-butyl N-[N'-[4-[(4-aminophenyl)carbamoylamino]phenyl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(NC(=O)Nc2ccc(N)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H32N6O5/c1-23(2,3)34-21(32)29-19(30-22(33)35-24(4,5)6)26-16-11-13-18(14-12-16)28-20(31)27-17-9-7-15(25)8-10-17/h7-14H,25H2,1-6H3,(H2,27,28,31)(H2,26,29,30,32,33) |
| InChIKey | BBQRNXIPRLREGR-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 156.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|