C35H47N7O8 — CID 135455010
tert-butyl N-[N'-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]acridin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate (PubChem CID 135455010) has the molecular formula C35H47N7O8 and a molecular weight of 693.80 g/mol. Its IUPAC name is tert-butyl N-[N'-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]acridin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]acridin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 135455010 |
| Molecular Formula | C35H47N7O8 |
| Molecular Weight | 693.80 g/mol |
| Exact Mass | 693.35 |
| IUPAC Name | tert-butyl N-[N'-[6-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]acridin-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc2cc3ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc3nc2c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H47N7O8/c1-32(2,3)47-28(43)39-26(40-29(44)48-33(4,5)6)36-22-15-13-20-17-21-14-16-23(19-25(21)38-24(20)18-22)37-27(41-30(45)49-34(7,8)9)42-31(46)50-35(10,11)12/h13-19H,1-12H3,(H2,36,39,40,43,44)(H2,37,41,42,45,46) |
| InChIKey | BPFXWZSUKGHAQK-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 190.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.80 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|