C26H30ClN3O8 — CID 176547419
carbon dioxide;(2-chloro-4-methylphenyl) 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 176547419) has the molecular formula C26H30ClN3O8 and a molecular weight of 547.99 g/mol. Its IUPAC name is carbon dioxide;(2-chloro-4-methylphenyl) 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | carbon dioxide;(2-chloro-4-methylphenyl) 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 176547419 |
| Molecular Formula | C26H30ClN3O8 |
| Molecular Weight | 547.99 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | carbon dioxide;(2-chloro-4-methylphenyl) 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)c(Cl)c1.O=C=O |
| InChI | InChI=1S/C25H30ClN3O6.CO2/c1-15-8-13-19(18(26)14-15)33-20(30)16-9-11-17(12-10-16)27-21(28-22(31)34-24(2,3)4)29-23(32)35-25(5,6)7;2-1-3/h8-14H,1-7H3,(H2,27,28,29,31,32); |
| InChIKey | MJLKBWXMCMTHHG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 149.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.99 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|