C32H41N5O8 — CID 155587056
[5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]imidazo[1,2-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 155587056) has the molecular formula C32H41N5O8 and a molecular weight of 623.71 g/mol. Its IUPAC name is [5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]imidazo[1,2-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | [5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]imidazo[1,2-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 155587056 |
| Molecular Formula | C32H41N5O8 |
| Molecular Weight | 623.71 g/mol |
| Exact Mass | 623.30 |
| IUPAC Name | [5-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]imidazo[1,2-a]pyridin-8-yl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(C)(C)OC(=O)CCc1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)c2nccn12 |
| InChI | InChI=1S/C32H41N5O8/c1-30(2,3)43-24(38)17-15-22-14-16-23(25-33-18-19-37(22)25)42-26(39)20-10-12-21(13-11-20)34-27(35-28(40)44-31(4,5)6)36-29(41)45-32(7,8)9/h10-14,16,18-19H,15,17H2,1-9H3,(H2,34,35,36,40,41) |
| InChIKey | PLJBIWRLURNFNY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 158.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.71 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|