C36H48N2O10 — CID 157119968
2-O,3-O-ditert-butyl 1-O-[2-[4-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoyl]oxyphenyl]ethyl] (2S)-propane-1,2,3-tricarboxylate (PubChem CID 157119968) has the molecular formula C36H48N2O10 and a molecular weight of 668.78 g/mol. Its IUPAC name is 2-O,3-O-ditert-butyl 1-O-[2-[4-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoyl]oxyphenyl]ethyl] (2S)-propane-1,2,3-tricarboxylate.
| Compound Name | 2-O,3-O-ditert-butyl 1-O-[2-[4-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoyl]oxyphenyl]ethyl] (2S)-propane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 157119968 |
| Molecular Formula | C36H48N2O10 |
| Molecular Weight | 668.78 g/mol |
| Exact Mass | 668.33 |
| IUPAC Name | 2-O,3-O-ditert-butyl 1-O-[2-[4-[4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoyl]oxyphenyl]ethyl] (2S)-propane-1,2,3-tricarboxylate |
| SMILES | C/C(=N\c1ccc(C(=O)Oc2ccc(CCOC(=O)C[C@@H](CC(=O)OC(C)(C)C)C(=O)OC(C)(C)C)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H48N2O10/c1-23(38-33(43)48-36(8,9)10)37-27-15-13-25(14-16-27)31(41)45-28-17-11-24(12-18-28)19-20-44-29(39)21-26(32(42)47-35(5,6)7)22-30(40)46-34(2,3)4/h11-18,26H,19-22H2,1-10H3,(H,37,38,43)/t26-/m0/s1 |
| InChIKey | AHVVKSJWTLTWAQ-SANMLTNESA-N |
| XLogP | 6.65 |
| TPSA | 155.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.78 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|