C36H52N4O10S — CID 162196001
[4-[[(2-methylpropan-2-yl)oxycarbonyl-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexyl]sulfamoyl]amino]methyl]phenyl] 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoate (PubChem CID 162196001) has the molecular formula C36H52N4O10S and a molecular weight of 732.90 g/mol. Its IUPAC name is [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexyl]sulfamoyl]amino]methyl]phenyl] 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoate.
| Compound Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexyl]sulfamoyl]amino]methyl]phenyl] 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoate |
|---|---|
| PubChem CID | 162196001 |
| Molecular Formula | C36H52N4O10S |
| Molecular Weight | 732.90 g/mol |
| Exact Mass | 732.34 |
| IUPAC Name | [4-[[(2-methylpropan-2-yl)oxycarbonyl-[[6-[(2-methylpropan-2-yl)oxy]-6-oxohexyl]sulfamoyl]amino]methyl]phenyl] 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethylideneamino]benzoate |
| SMILES | C/C(=N\c1ccc(C(=O)Oc2ccc(CN(C(=O)OC(C)(C)C)S(=O)(=O)NCCCCCC(=O)OC(C)(C)C)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H52N4O10S/c1-25(39-32(43)49-35(5,6)7)38-28-19-17-27(18-20-28)31(42)47-29-21-15-26(16-22-29)24-40(33(44)50-36(8,9)10)51(45,46)37-23-13-11-12-14-30(41)48-34(2,3)4/h15-22,37H,11-14,23-24H2,1-10H3,(H,38,39,43) |
| InChIKey | ZQYDSNPEJNPRAY-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 179.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.90 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|