C34H41N3O6 — CID 136933603
[4-(4-phenylbutyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 136933603) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is [4-(4-phenylbutyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | [4-(4-phenylbutyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 136933603 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | [4-(4-phenylbutyl)phenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(C(=O)Oc2ccc(CCCCc3ccccc3)cc2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C34H41N3O6/c1-33(2,3)42-31(39)36-30(37-32(40)43-34(4,5)6)35-27-20-18-26(19-21-27)29(38)41-28-22-16-25(17-23-28)15-11-10-14-24-12-8-7-9-13-24/h7-9,12-13,16-23H,10-11,14-15H2,1-6H3,(H2,35,36,37,39,40) |
| InChIKey | WUVRXQGEFLXYLB-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 115.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|