C27H33N3O9 — CID 136933614
2-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-3-methoxyphenyl]acetic acid (PubChem CID 136933614) has the molecular formula C27H33N3O9 and a molecular weight of 543.57 g/mol. Its IUPAC name is 2-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-3-methoxyphenyl]acetic acid.
| Compound Name | 2-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-3-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 136933614 |
| Molecular Formula | C27H33N3O9 |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-3-methoxyphenyl]acetic acid |
| SMILES | COc1cc(CC(=O)O)ccc1OC(=O)c1ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C27H33N3O9/c1-26(2,3)38-24(34)29-23(30-25(35)39-27(4,5)6)28-18-11-9-17(10-12-18)22(33)37-19-13-8-16(15-21(31)32)14-20(19)36-7/h8-14H,15H2,1-7H3,(H,31,32)(H2,28,29,30,34,35) |
| InChIKey | OQWUEKWAAIVPKE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 161.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|