C38H47ClN4O7 — CID 136933684
[4-[3-[(4-tert-butylphenyl)methylamino]-3-oxopropyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate (PubChem CID 136933684) has the molecular formula C38H47ClN4O7 and a molecular weight of 707.27 g/mol. Its IUPAC name is [4-[3-[(4-tert-butylphenyl)methylamino]-3-oxopropyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate.
| Compound Name | [4-[3-[(4-tert-butylphenyl)methylamino]-3-oxopropyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
|---|---|
| PubChem CID | 136933684 |
| Molecular Formula | C38H47ClN4O7 |
| Molecular Weight | 707.27 g/mol |
| Exact Mass | 706.31 |
| IUPAC Name | [4-[3-[(4-tert-butylphenyl)methylamino]-3-oxopropyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(C(=O)Oc2ccc(CCC(=O)NCc3ccc(C(C)(C)C)cc3)c(Cl)c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C38H47ClN4O7/c1-36(2,3)27-16-10-24(11-17-27)23-40-31(44)21-15-25-14-20-29(22-30(25)39)48-32(45)26-12-18-28(19-13-26)41-33(42-34(46)49-37(4,5)6)43-35(47)50-38(7,8)9/h10-14,16-20,22H,15,21,23H2,1-9H3,(H,40,44)(H2,41,42,43,46,47) |
| InChIKey | YRADBPHWLHCCBK-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 144.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.27 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|