C45H58ClN5O10 — CID 136933641
tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]propanoyl-(2-morpholin-4-ylethyl)amino]methyl]benzoate (PubChem CID 136933641) has the molecular formula C45H58ClN5O10 and a molecular weight of 864.44 g/mol. Its IUPAC name is tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]propanoyl-(2-morpholin-4-ylethyl)amino]methyl]benzoate.
| Compound Name | tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]propanoyl-(2-morpholin-4-ylethyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 136933641 |
| Molecular Formula | C45H58ClN5O10 |
| Molecular Weight | 864.44 g/mol |
| Exact Mass | 863.39 |
| IUPAC Name | tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]propanoyl-(2-morpholin-4-ylethyl)amino]methyl]benzoate |
| SMILES | CC(C)(C)OC(=O)NC(=Nc1ccc(C(=O)Oc2ccc(CCC(=O)N(CCN3CCOCC3)Cc3cccc(C(=O)OC(C)(C)C)c3)c(Cl)c2)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C45H58ClN5O10/c1-43(2,3)59-39(54)33-12-10-11-30(27-33)29-51(22-21-50-23-25-57-26-24-50)37(52)20-16-31-15-19-35(28-36(31)46)58-38(53)32-13-17-34(18-14-32)47-40(48-41(55)60-44(4,5)6)49-42(56)61-45(7,8)9/h10-15,17-19,27-28H,16,20-26,29H2,1-9H3,(H2,47,48,49,55,56) |
| InChIKey | OYJYVRAPHFEVRU-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 174.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.44 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|