C43H56ClN5O9 — CID 136933609
tert-butyl 3-[[[[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]-methylcarbamoyl]-(2,2-dimethylpropyl)amino]methyl]benzoate (PubChem CID 136933609) has the molecular formula C43H56ClN5O9 and a molecular weight of 822.40 g/mol. Its IUPAC name is tert-butyl 3-[[[[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]-methylcarbamoyl]-(2,2-dimethylpropyl)amino]methyl]benzoate.
| Compound Name | tert-butyl 3-[[[[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]-methylcarbamoyl]-(2,2-dimethylpropyl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 136933609 |
| Molecular Formula | C43H56ClN5O9 |
| Molecular Weight | 822.40 g/mol |
| Exact Mass | 821.38 |
| IUPAC Name | tert-butyl 3-[[[[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]-methylcarbamoyl]-(2,2-dimethylpropyl)amino]methyl]benzoate |
| SMILES | CN(C(=O)N(Cc1cccc(C(=O)OC(C)(C)C)c1)CC(C)(C)C)c1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)cc1Cl |
| InChI | InChI=1S/C43H56ClN5O9/c1-40(2,3)26-49(25-27-15-14-16-29(23-27)35(51)56-41(4,5)6)39(54)48(13)33-22-21-31(24-32(33)44)55-34(50)28-17-19-30(20-18-28)45-36(46-37(52)57-42(7,8)9)47-38(53)58-43(10,11)12/h14-24H,25-26H2,1-13H3,(H2,45,46,47,52,53) |
| InChIKey | TWZAHRYSJFAIOQ-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 165.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.40 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|