C45H57ClN4O11 — CID 176522175
[4-[[3-(3-tert-butylphenyl)propanoyl-(2,2-dimethylpropyl)amino]methyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate;bis(carbon dioxide) (PubChem CID 176522175) has the molecular formula C45H57ClN4O11 and a molecular weight of 865.42 g/mol. Its IUPAC name is [4-[[3-(3-tert-butylphenyl)propanoyl-(2,2-dimethylpropyl)amino]methyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate;bis(carbon dioxide).
| Compound Name | [4-[[3-(3-tert-butylphenyl)propanoyl-(2,2-dimethylpropyl)amino]methyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate;bis(carbon dioxide) |
|---|---|
| PubChem CID | 176522175 |
| Molecular Formula | C45H57ClN4O11 |
| Molecular Weight | 865.42 g/mol |
| Exact Mass | 864.37 |
| IUPAC Name | [4-[[3-(3-tert-butylphenyl)propanoyl-(2,2-dimethylpropyl)amino]methyl]-3-chlorophenyl] 4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoate;bis(carbon dioxide) |
| SMILES | CC(C)(C)CN(Cc1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)cc1Cl)C(=O)CCc1cccc(C(C)(C)C)c1.O=C=O.O=C=O |
| InChI | InChI=1S/C43H57ClN4O7.2CO2/c1-40(2,3)27-48(35(49)23-16-28-14-13-15-31(24-28)41(4,5)6)26-30-19-22-33(25-34(30)44)53-36(50)29-17-20-32(21-18-29)45-37(46-38(51)54-42(7,8)9)47-39(52)55-43(10,11)12;2*2-1-3/h13-15,17-22,24-25H,16,23,26-27H2,1-12H3,(H2,45,46,47,51,52);; |
| InChIKey | FWWMGQTYZCHOLA-UHFFFAOYSA-N |
| XLogP | 8.73 |
| TPSA | 203.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 865.42 |
| LogP ≤ 5 | 8.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|