C46H59ClN4O11 — CID 176525650
tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]butanoyl-(2,2-dimethylpropyl)amino]methyl]benzoate;carbon dioxide (PubChem CID 176525650) has the molecular formula C46H59ClN4O11 and a molecular weight of 879.45 g/mol. Its IUPAC name is tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]butanoyl-(2,2-dimethylpropyl)amino]methyl]benzoate;carbon dioxide.
| Compound Name | tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]butanoyl-(2,2-dimethylpropyl)amino]methyl]benzoate;carbon dioxide |
|---|---|
| PubChem CID | 176525650 |
| Molecular Formula | C46H59ClN4O11 |
| Molecular Weight | 879.45 g/mol |
| Exact Mass | 878.39 |
| IUPAC Name | tert-butyl 3-[[3-[4-[4-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]benzoyl]oxy-2-chlorophenyl]butanoyl-(2,2-dimethylpropyl)amino]methyl]benzoate;carbon dioxide |
| SMILES | CC(CC(=O)N(Cc1cccc(C(=O)OC(C)(C)C)c1)CC(C)(C)C)c1ccc(OC(=O)c2ccc(N=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)cc2)cc1Cl.O=C=O |
| InChI | InChI=1S/C45H59ClN4O9.CO2/c1-28(23-36(51)50(27-42(2,3)4)26-29-15-14-16-31(24-29)38(53)57-43(5,6)7)34-22-21-33(25-35(34)46)56-37(52)30-17-19-32(20-18-30)47-39(48-40(54)58-44(8,9)10)49-41(55)59-45(11,12)13;2-1-3/h14-22,24-25,28H,23,26-27H2,1-13H3,(H2,47,48,49,54,55); |
| InChIKey | FBIFNODZMSWCLY-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 196.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.45 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|