C27H26ClN5O7 — CID 90291207
3-[[(2-aminooxy-2-oxoethyl)-[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]amino]methyl]benzoic acid (PubChem CID 90291207) has the molecular formula C27H26ClN5O7 and a molecular weight of 567.99 g/mol. Its IUPAC name is 3-[[(2-aminooxy-2-oxoethyl)-[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[(2-aminooxy-2-oxoethyl)-[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 90291207 |
| Molecular Formula | C27H26ClN5O7 |
| Molecular Weight | 567.99 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 3-[[(2-aminooxy-2-oxoethyl)-[2-[2-chloro-4-[4-(diaminomethylideneamino)benzoyl]oxyphenyl]propanoyl]amino]methyl]benzoic acid |
| SMILES | CC(C(=O)N(CC(=O)ON)Cc1cccc(C(=O)O)c1)c1ccc(OC(=O)c2ccc(N=C(N)N)cc2)cc1Cl |
| InChI | InChI=1S/C27H26ClN5O7/c1-15(24(35)33(14-23(34)40-31)13-16-3-2-4-18(11-16)25(36)37)21-10-9-20(12-22(21)28)39-26(38)17-5-7-19(8-6-17)32-27(29)30/h2-12,15H,13-14,31H2,1H3,(H,36,37)(H4,29,30,32) |
| InChIKey | HYFHLAXIDIPROZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 200.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.99 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|