C29H26N4O8 — CID 134502121
3-[[carboxymethyl-[3-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzofuran-3-yl]-2-oxopropyl]amino]methyl]benzoic acid (PubChem CID 134502121) has the molecular formula C29H26N4O8 and a molecular weight of 558.55 g/mol. Its IUPAC name is 3-[[carboxymethyl-[3-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzofuran-3-yl]-2-oxopropyl]amino]methyl]benzoic acid.
| Compound Name | 3-[[carboxymethyl-[3-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzofuran-3-yl]-2-oxopropyl]amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 134502121 |
| Molecular Formula | C29H26N4O8 |
| Molecular Weight | 558.55 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 3-[[carboxymethyl-[3-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzofuran-3-yl]-2-oxopropyl]amino]methyl]benzoic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(CC(=O)CN(CC(=O)O)Cc4cccc(C(=O)O)c4)coc3c2)cc1 |
| InChI | InChI=1S/C29H26N4O8/c30-29(31)32-21-6-4-18(5-7-21)28(39)41-23-8-9-24-20(16-40-25(24)12-23)11-22(34)14-33(15-26(35)36)13-17-2-1-3-19(10-17)27(37)38/h1-10,12,16H,11,13-15H2,(H,35,36)(H,37,38)(H4,30,31,32) |
| InChIKey | WKXPHWHCIQPASI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 198.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|