C29H22N4O7S2 — CID 90432191
5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid (PubChem CID 90432191) has the molecular formula C29H22N4O7S2 and a molecular weight of 602.65 g/mol. Its IUPAC name is 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid.
| Compound Name | 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 90432191 |
| Molecular Formula | C29H22N4O7S2 |
| Molecular Weight | 602.65 g/mol |
| Exact Mass | 602.09 |
| IUPAC Name | 5-[[carboxymethyl-[6-[4-(diaminomethylideneamino)benzoyl]oxy-1-benzothiophene-3-carbonyl]amino]methyl]-1-benzothiophene-2-carboxylic acid |
| SMILES | NC(N)=Nc1ccc(C(=O)Oc2ccc3c(C(=O)N(CC(=O)O)Cc4ccc5sc(C(=O)O)cc5c4)csc3c2)cc1 |
| InChI | InChI=1S/C29H22N4O7S2/c30-29(31)32-18-4-2-16(3-5-18)28(39)40-19-6-7-20-21(14-41-23(20)11-19)26(36)33(13-25(34)35)12-15-1-8-22-17(9-15)10-24(42-22)27(37)38/h1-11,14H,12-13H2,(H,34,35)(H,37,38)(H4,30,31,32) |
| InChIKey | JGJDATHARKSWGU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 185.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|